C14H27N5 — CID 107078389
N'-ethyl-2,2-dimethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propane-1,3-diamine (PubChem CID 107078389) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is N'-ethyl-2,2-dimethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-ethyl-2,2-dimethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 107078389 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | N'-ethyl-2,2-dimethyl-N'-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)propane-1,3-diamine |
| SMILES | CCN(Cc1nnc2n1CCCC2)CC(C)(C)CN |
| InChI | InChI=1S/C14H27N5/c1-4-18(11-14(2,3)10-15)9-13-17-16-12-7-5-6-8-19(12)13/h4-11,15H2,1-3H3 |
| InChIKey | XWPYFZWZIGFBRX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |