C13H24N4 — CID 113308654
2-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)butan-1-amine (PubChem CID 113308654) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)butan-1-amine.
| Compound Name | 2-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 113308654 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-ethyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)butan-1-amine |
| SMILES | CCC(CC)(CN)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C13H24N4/c1-3-13(4-2,10-14)12-16-15-11-8-6-5-7-9-17(11)12/h3-10,14H2,1-2H3 |
| InChIKey | LUSNVBMCIBXEBS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |