C18H24ClN3 — CID 142840407
3-[(2R)-2-(4-chlorophenyl)butan-2-yl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine (PubChem CID 142840407) has the molecular formula C18H24ClN3 and a molecular weight of 317.86 g/mol. Its IUPAC name is 3-[(2R)-2-(4-chlorophenyl)butan-2-yl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine.
| Compound Name | 3-[(2R)-2-(4-chlorophenyl)butan-2-yl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
|---|---|
| PubChem CID | 142840407 |
| Molecular Formula | C18H24ClN3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-[(2R)-2-(4-chlorophenyl)butan-2-yl]-5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocine |
| SMILES | CC[C@](C)(c1ccc(Cl)cc1)c1nnc2n1CCCCCC2 |
| InChI | InChI=1S/C18H24ClN3/c1-3-18(2,14-9-11-15(19)12-10-14)17-21-20-16-8-6-4-5-7-13-22(16)17/h9-12H,3-8,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | NNWLIWXSFLISPV-GOSISDBHSA-N |
| XLogP | 4.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |