C15H18N4O2 — CID 107078609
5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl 2-(4-aminophenyl)acetate (PubChem CID 107078609) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl 2-(4-aminophenyl)acetate.
| Compound Name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl 2-(4-aminophenyl)acetate |
|---|---|
| PubChem CID | 107078609 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl 2-(4-aminophenyl)acetate |
| SMILES | Nc1ccc(CC(=O)OCc2nnc3n2CCCC3)cc1 |
| InChI | InChI=1S/C15H18N4O2/c16-12-6-4-11(5-7-12)9-15(20)21-10-14-18-17-13-3-1-2-8-19(13)14/h4-7H,1-3,8-10,16H2 |
| InChIKey | DRUPBMRXBKNFBJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|