C17H22BrN3 — CID 107080390
4-(bromomethyl)-N-(1-cyclopropylethyl)-N,3-dimethyl-1-phenylpyrazol-5-amine (PubChem CID 107080390) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(1-cyclopropylethyl)-N,3-dimethyl-1-phenylpyrazol-5-amine.
| Compound Name | 4-(bromomethyl)-N-(1-cyclopropylethyl)-N,3-dimethyl-1-phenylpyrazol-5-amine |
|---|---|
| PubChem CID | 107080390 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-(bromomethyl)-N-(1-cyclopropylethyl)-N,3-dimethyl-1-phenylpyrazol-5-amine |
| SMILES | Cc1nn(-c2ccccc2)c(N(C)C(C)C2CC2)c1CBr |
| InChI | InChI=1S/C17H22BrN3/c1-12-16(11-18)17(20(3)13(2)14-9-10-14)21(19-12)15-7-5-4-6-8-15/h4-8,13-14H,9-11H2,1-3H3 |
| InChIKey | GQPVQJUAELVWCV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|