C16H20ClN3O — CID 82730439
4-(chloromethyl)-N,3-dimethyl-N-(oxolan-3-yl)-1-phenylpyrazol-5-amine (PubChem CID 82730439) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-(chloromethyl)-N,3-dimethyl-N-(oxolan-3-yl)-1-phenylpyrazol-5-amine.
| Compound Name | 4-(chloromethyl)-N,3-dimethyl-N-(oxolan-3-yl)-1-phenylpyrazol-5-amine |
|---|---|
| PubChem CID | 82730439 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-(chloromethyl)-N,3-dimethyl-N-(oxolan-3-yl)-1-phenylpyrazol-5-amine |
| SMILES | Cc1nn(-c2ccccc2)c(N(C)C2CCOC2)c1CCl |
| InChI | InChI=1S/C16H20ClN3O/c1-12-15(10-17)16(19(2)14-8-9-21-11-14)20(18-12)13-6-4-3-5-7-13/h3-7,14H,8-11H2,1-2H3 |
| InChIKey | FOQVZMNWXZQPNL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|