C15H16BrClN2 — CID 107080718
2-(bromomethyl)-5-chloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline (PubChem CID 107080718) has the molecular formula C15H16BrClN2 and a molecular weight of 339.66 g/mol. Its IUPAC name is 2-(bromomethyl)-5-chloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline.
| Compound Name | 2-(bromomethyl)-5-chloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 107080718 |
| Molecular Formula | C15H16BrClN2 |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-(bromomethyl)-5-chloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline |
| SMILES | CN(CCc1ccncc1)c1cc(Cl)ccc1CBr |
| InChI | InChI=1S/C15H16BrClN2/c1-19(9-6-12-4-7-18-8-5-12)15-10-14(17)3-2-13(15)11-16/h2-5,7-8,10H,6,9,11H2,1H3 |
| InChIKey | IUGFOFORJLTXGO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|