C14H14Cl2N2 — CID 110454690
2,3-dichloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline (PubChem CID 110454690) has the molecular formula C14H14Cl2N2 and a molecular weight of 281.19 g/mol. Its IUPAC name is 2,3-dichloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline.
| Compound Name | 2,3-dichloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 110454690 |
| Molecular Formula | C14H14Cl2N2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,3-dichloro-N-methyl-N-(2-pyridin-4-ylethyl)aniline |
| SMILES | CN(CCc1ccncc1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H14Cl2N2/c1-18(10-7-11-5-8-17-9-6-11)13-4-2-3-12(15)14(13)16/h2-6,8-9H,7,10H2,1H3 |
| InChIKey | YZCJPJBFMGEYSK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |