C10H15BrN2O — CID 107081177
5-(bromomethyl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine (PubChem CID 107081177) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 5-(bromomethyl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine.
| Compound Name | 5-(bromomethyl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107081177 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 5-(bromomethyl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine |
| SMILES | COCCN(C)c1ccc(CBr)cn1 |
| InChI | InChI=1S/C10H15BrN2O/c1-13(5-6-14-2)10-4-3-9(7-11)8-12-10/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | SOFQTKAHVISISP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|