C13H23N3O — CID 81056741
N-(2-ethoxyethyl)-5-(ethylaminomethyl)-N-methylpyridin-2-amine (PubChem CID 81056741) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-(ethylaminomethyl)-N-methylpyridin-2-amine.
| Compound Name | N-(2-ethoxyethyl)-5-(ethylaminomethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 81056741 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-(2-ethoxyethyl)-5-(ethylaminomethyl)-N-methylpyridin-2-amine |
| SMILES | CCNCc1ccc(N(C)CCOCC)nc1 |
| InChI | InChI=1S/C13H23N3O/c1-4-14-10-12-6-7-13(15-11-12)16(3)8-9-17-5-2/h6-7,11,14H,4-5,8-10H2,1-3H3 |
| InChIKey | ZOURGKCGHFDNSH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|