C11H19N3O — CID 80630489
2-[[5-(ethylaminomethyl)-2-pyridinyl]-methylamino]ethanol (PubChem CID 80630489) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[[5-(ethylaminomethyl)-2-pyridinyl]-methylamino]ethanol.
| Compound Name | 2-[[5-(ethylaminomethyl)-2-pyridinyl]-methylamino]ethanol |
|---|---|
| PubChem CID | 80630489 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-[[5-(ethylaminomethyl)-2-pyridinyl]-methylamino]ethanol |
| SMILES | CCNCc1ccc(N(C)CCO)nc1 |
| InChI | InChI=1S/C11H19N3O/c1-3-12-8-10-4-5-11(13-9-10)14(2)6-7-15/h4-5,9,12,15H,3,6-8H2,1-2H3 |
| InChIKey | BFQKGVPNYJQKCE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |