C13H18BrNO — CID 107081198
4-[2-(bromomethyl)phenyl]-3,3-dimethylmorpholine (PubChem CID 107081198) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 4-[2-(bromomethyl)phenyl]-3,3-dimethylmorpholine.
| Compound Name | 4-[2-(bromomethyl)phenyl]-3,3-dimethylmorpholine |
|---|---|
| PubChem CID | 107081198 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-[2-(bromomethyl)phenyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1c1ccccc1CBr |
| InChI | InChI=1S/C13H18BrNO/c1-13(2)10-16-8-7-15(13)12-6-4-3-5-11(12)9-14/h3-6H,7-10H2,1-2H3 |
| InChIKey | RITDFTVCFJUREP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|