About (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine
(1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine (PubChem CID 55191185) has the molecular formula C14H21FN2O
and a molecular weight of 252.33 g/mol. Its IUPAC name is (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine |
| PubChem CID | 55191185 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine |
| SMILES | C[C@H](N)c1c(F)cccc1N1CCOCC1(C)C |
| InChI | InChI=1S/C14H21FN2O/c1-10(16)13-11(15)5-4-6-12(13)17-7-8-18-9-14(17,2)3/h4-6,10H,7-9,16H2,1-3H3/t10-/m0/s1 |
| InChIKey | PRGRIGFNUBRYBO-JTQLQIEISA-N |
| XLogP | 2.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine?
The IUPAC name of (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine (CID 55191185) is (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine.
What is the SMILES notation for (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine?
The canonical SMILES for (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine is C[C@H](N)c1c(F)cccc1N1CCOCC1(C)C.
What is the InChIKey of (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine?
The InChIKey is PRGRIGFNUBRYBO-JTQLQIEISA-N. The full InChI is InChI=1S/C14H21FN2O/c1-10(16)13-11(15)5-4-6-12(13)17-7-8-18-9-14(17,2)3/h4-6,10H,7-9,16H2,1-3H3/t10-/m0/s1.
What are the key properties of (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine?
(1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine has a molecular weight of 252.33 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[2-(3,3-dimethylmorpholin-4-yl)-6-fluorophenyl]ethanamine is sourced from PubChem (CID 55191185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).