C16H17FN2 — CID 78935636
(1R)-1-[2-(1,3-dihydroisoindol-2-yl)-6-fluorophenyl]ethanamine (PubChem CID 78935636) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is (1R)-1-[2-(1,3-dihydroisoindol-2-yl)-6-fluorophenyl]ethanamine.
| Compound Name | (1R)-1-[2-(1,3-dihydroisoindol-2-yl)-6-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 78935636 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (1R)-1-[2-(1,3-dihydroisoindol-2-yl)-6-fluorophenyl]ethanamine |
| SMILES | C[C@@H](N)c1c(F)cccc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H17FN2/c1-11(18)16-14(17)7-4-8-15(16)19-9-12-5-2-3-6-13(12)10-19/h2-8,11H,9-10,18H2,1H3/t11-/m1/s1 |
| InChIKey | NTQLPEQVFJPYEL-LLVKDONJSA-N |
| XLogP | 3.37 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |