About 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine
5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine (PubChem CID 107081935) has the molecular formula C14H23BrN2
and a molecular weight of 299.26 g/mol. Its IUPAC name is 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine |
| PubChem CID | 107081935 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine |
| SMILES | Cc1cc(CBr)cnc1N(C)C(C)CC(C)C |
| InChI | InChI=1S/C14H23BrN2/c1-10(2)6-12(4)17(5)14-11(3)7-13(8-15)9-16-14/h7,9-10,12H,6,8H2,1-5H3 |
| InChIKey | ASIBHLLBIJRKAE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine?
The IUPAC name of 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine (CID 107081935) is 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine.
What is the SMILES notation for 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine?
The canonical SMILES for 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine is Cc1cc(CBr)cnc1N(C)C(C)CC(C)C.
What is the InChIKey of 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine?
The InChIKey is ASIBHLLBIJRKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrN2/c1-10(2)6-12(4)17(5)14-11(3)7-13(8-15)9-16-14/h7,9-10,12H,6,8H2,1-5H3.
What are the key properties of 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine?
5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine has a molecular weight of 299.26 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-N,3-dimethyl-N-(4-methylpentan-2-yl)pyridin-2-amine is sourced from PubChem (CID 107081935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).