C14H21BrN2 — CID 107082704
5-(bromomethyl)-2-(2,3-dimethylpiperidin-1-yl)-3-methylpyridine (PubChem CID 107082704) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(2,3-dimethylpiperidin-1-yl)-3-methylpyridine.
| Compound Name | 5-(bromomethyl)-2-(2,3-dimethylpiperidin-1-yl)-3-methylpyridine |
|---|---|
| PubChem CID | 107082704 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-(bromomethyl)-2-(2,3-dimethylpiperidin-1-yl)-3-methylpyridine |
| SMILES | Cc1cc(CBr)cnc1N1CCCC(C)C1C |
| InChI | InChI=1S/C14H21BrN2/c1-10-5-4-6-17(12(10)3)14-11(2)7-13(8-15)9-16-14/h7,9-10,12H,4-6,8H2,1-3H3 |
| InChIKey | GJCXVYBYEMAHDH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|