C12H17BrN2S — CID 107083852
4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-3-methylthiomorpholine (PubChem CID 107083852) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-3-methylthiomorpholine.
| Compound Name | 4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-3-methylthiomorpholine |
|---|---|
| PubChem CID | 107083852 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-3-methylthiomorpholine |
| SMILES | Cc1cc(CBr)cnc1N1CCSCC1C |
| InChI | InChI=1S/C12H17BrN2S/c1-9-5-11(6-13)7-14-12(9)15-3-4-16-8-10(15)2/h5,7,10H,3-4,6,8H2,1-2H3 |
| InChIKey | DPQYUDMNEIFKTA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|