C13H17BrF3N3 — CID 107082997
1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 107082997) has the molecular formula C13H17BrF3N3 and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 107082997 |
| Molecular Formula | C13H17BrF3N3 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-[5-(bromomethyl)-3-methyl-2-pyridinyl]-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | Cc1cc(CBr)cnc1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17BrF3N3/c1-10-6-11(7-14)8-18-12(10)20-4-2-19(3-5-20)9-13(15,16)17/h6,8H,2-5,7,9H2,1H3 |
| InChIKey | BZWUGONZBUFXSZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|