C12H17BrN2O — CID 107082975
4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-1,4-oxazepane (PubChem CID 107082975) has the molecular formula C12H17BrN2O and a molecular weight of 285.18 g/mol. Its IUPAC name is 4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-1,4-oxazepane.
| Compound Name | 4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 107082975 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 4-[5-(bromomethyl)-3-methyl-2-pyridinyl]-1,4-oxazepane |
| SMILES | Cc1cc(CBr)cnc1N1CCCOCC1 |
| InChI | InChI=1S/C12H17BrN2O/c1-10-7-11(8-13)9-14-12(10)15-3-2-5-16-6-4-15/h7,9H,2-6,8H2,1H3 |
| InChIKey | BGGHVXSIONHVFC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|