C17H25BrFN — CID 107084629
2-(bromomethyl)-N-cyclopentyl-4-fluoro-N-(3-methylbutyl)aniline (PubChem CID 107084629) has the molecular formula C17H25BrFN and a molecular weight of 342.30 g/mol. Its IUPAC name is 2-(bromomethyl)-N-cyclopentyl-4-fluoro-N-(3-methylbutyl)aniline.
| Compound Name | 2-(bromomethyl)-N-cyclopentyl-4-fluoro-N-(3-methylbutyl)aniline |
|---|---|
| PubChem CID | 107084629 |
| Molecular Formula | C17H25BrFN |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(bromomethyl)-N-cyclopentyl-4-fluoro-N-(3-methylbutyl)aniline |
| SMILES | CC(C)CCN(c1ccc(F)cc1CBr)C1CCCC1 |
| InChI | InChI=1S/C17H25BrFN/c1-13(2)9-10-20(16-5-3-4-6-16)17-8-7-15(19)11-14(17)12-18/h7-8,11,13,16H,3-6,9-10,12H2,1-2H3 |
| InChIKey | NXWNLUNPXVEONT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|