C13H17BrN2O3 — CID 107084847
N-[2-(bromomethyl)-4-nitrophenyl]-N,2-dimethyloxolan-3-amine (PubChem CID 107084847) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is N-[2-(bromomethyl)-4-nitrophenyl]-N,2-dimethyloxolan-3-amine.
| Compound Name | N-[2-(bromomethyl)-4-nitrophenyl]-N,2-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 107084847 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | N-[2-(bromomethyl)-4-nitrophenyl]-N,2-dimethyloxolan-3-amine |
| SMILES | CC1OCCC1N(C)c1ccc([N+](=O)[O-])cc1CBr |
| InChI | InChI=1S/C13H17BrN2O3/c1-9-12(5-6-19-9)15(2)13-4-3-11(16(17)18)7-10(13)8-14/h3-4,7,9,12H,5-6,8H2,1-2H3 |
| InChIKey | BKKUAONFGXFJGX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|