C12H15BrClNO — CID 107085598
1-[2-(bromomethyl)-5-chlorophenyl]-3-methoxypyrrolidine (PubChem CID 107085598) has the molecular formula C12H15BrClNO and a molecular weight of 304.62 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-chlorophenyl]-3-methoxypyrrolidine.
| Compound Name | 1-[2-(bromomethyl)-5-chlorophenyl]-3-methoxypyrrolidine |
|---|---|
| PubChem CID | 107085598 |
| Molecular Formula | C12H15BrClNO |
| Molecular Weight | 304.62 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 1-[2-(bromomethyl)-5-chlorophenyl]-3-methoxypyrrolidine |
| SMILES | COC1CCN(c2cc(Cl)ccc2CBr)C1 |
| InChI | InChI=1S/C12H15BrClNO/c1-16-11-4-5-15(8-11)12-6-10(14)3-2-9(12)7-13/h2-3,6,11H,4-5,7-8H2,1H3 |
| InChIKey | RLHGFZTYURVRDK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|