C13H18BrNO — CID 107085484
1-[2-(bromomethyl)phenyl]-3-methoxypiperidine (PubChem CID 107085484) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 1-[2-(bromomethyl)phenyl]-3-methoxypiperidine.
| Compound Name | 1-[2-(bromomethyl)phenyl]-3-methoxypiperidine |
|---|---|
| PubChem CID | 107085484 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-[2-(bromomethyl)phenyl]-3-methoxypiperidine |
| SMILES | COC1CCCN(c2ccccc2CBr)C1 |
| InChI | InChI=1S/C13H18BrNO/c1-16-12-6-4-8-15(10-12)13-7-3-2-5-11(13)9-14/h2-3,5,7,12H,4,6,8-10H2,1H3 |
| InChIKey | JEUBOUMKRBSVBX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|