C15H22N2O — CID 102965800
5-(3-methoxypiperidin-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 102965800) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-(3-methoxypiperidin-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(3-methoxypiperidin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 102965800 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-(3-methoxypiperidin-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COC1CCCN(c2cccc3c2CCCN3)C1 |
| InChI | InChI=1S/C15H22N2O/c1-18-12-5-4-10-17(11-12)15-8-2-7-14-13(15)6-3-9-16-14/h2,7-8,12,16H,3-6,9-11H2,1H3 |
| InChIKey | JNWZZYUTWJQPSP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |