C15H22N2O — CID 81215266
2,6-dimethyl-4-(1,2,3,4-tetrahydroquinolin-5-yl)morpholine (PubChem CID 81215266) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,2,3,4-tetrahydroquinolin-5-yl)morpholine.
| Compound Name | 2,6-dimethyl-4-(1,2,3,4-tetrahydroquinolin-5-yl)morpholine |
|---|---|
| PubChem CID | 81215266 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2,6-dimethyl-4-(1,2,3,4-tetrahydroquinolin-5-yl)morpholine |
| SMILES | CC1CN(c2cccc3c2CCCN3)CC(C)O1 |
| InChI | InChI=1S/C15H22N2O/c1-11-9-17(10-12(2)18-11)15-7-3-6-14-13(15)5-4-8-16-14/h3,6-7,11-12,16H,4-5,8-10H2,1-2H3 |
| InChIKey | UIGOYMHXGPUVAK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |