C17H24N2 — CID 82749910
5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 82749910) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82749910 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(c(N3CCC4CCCCC43)c1)CCCN2 |
| InChI | InChI=1S/C17H24N2/c1-2-8-16-13(5-1)10-12-19(16)17-9-3-7-15-14(17)6-4-11-18-15/h3,7,9,13,16,18H,1-2,4-6,8,10-12H2 |
| InChIKey | RFYRSSAIIARMKN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |