C15H14BrClO — CID 107086782
1-[2-(bromomethyl)-4-chlorophenoxy]-2,3-dimethylbenzene (PubChem CID 107086782) has the molecular formula C15H14BrClO and a molecular weight of 325.63 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-chlorophenoxy]-2,3-dimethylbenzene.
| Compound Name | 1-[2-(bromomethyl)-4-chlorophenoxy]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 107086782 |
| Molecular Formula | C15H14BrClO |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1-[2-(bromomethyl)-4-chlorophenoxy]-2,3-dimethylbenzene |
| SMILES | Cc1cccc(Oc2ccc(Cl)cc2CBr)c1C |
| InChI | InChI=1S/C15H14BrClO/c1-10-4-3-5-14(11(10)2)18-15-7-6-13(17)8-12(15)9-16/h3-8H,9H2,1-2H3 |
| InChIKey | MQAZIUNAJXACJV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|