C16H15BrN2O — CID 107087014
3-(bromomethyl)-2-(3,5-dimethylphenoxy)imidazo[1,2-a]pyridine (PubChem CID 107087014) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(3,5-dimethylphenoxy)imidazo[1,2-a]pyridine.
| Compound Name | 3-(bromomethyl)-2-(3,5-dimethylphenoxy)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 107087014 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-(bromomethyl)-2-(3,5-dimethylphenoxy)imidazo[1,2-a]pyridine |
| SMILES | Cc1cc(C)cc(Oc2nc3ccccn3c2CBr)c1 |
| InChI | InChI=1S/C16H15BrN2O/c1-11-7-12(2)9-13(8-11)20-16-14(10-17)19-6-4-3-5-15(19)18-16/h3-9H,10H2,1-2H3 |
| InChIKey | KMMQQVIZLXNJAX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|