C14H9BrClFN2O — CID 81331656
2-(3-bromo-5-fluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine (PubChem CID 81331656) has the molecular formula C14H9BrClFN2O and a molecular weight of 355.59 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(3-bromo-5-fluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 81331656 |
| Molecular Formula | C14H9BrClFN2O |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 2-(3-bromo-5-fluorophenoxy)-3-(chloromethyl)imidazo[1,2-a]pyridine |
| SMILES | Fc1cc(Br)cc(Oc2nc3ccccn3c2CCl)c1 |
| InChI | InChI=1S/C14H9BrClFN2O/c15-9-5-10(17)7-11(6-9)20-14-12(8-16)19-4-2-1-3-13(19)18-14/h1-7H,8H2 |
| InChIKey | OHJNIICCANUORQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|