C17H19BrO — CID 107087431
1-[4-(bromomethyl)-3-methylphenoxy]-2,3,5-trimethylbenzene (PubChem CID 107087431) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-3-methylphenoxy]-2,3,5-trimethylbenzene.
| Compound Name | 1-[4-(bromomethyl)-3-methylphenoxy]-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 107087431 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-[4-(bromomethyl)-3-methylphenoxy]-2,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C)c(Oc2ccc(CBr)c(C)c2)c1 |
| InChI | InChI=1S/C17H19BrO/c1-11-7-12(2)14(4)17(8-11)19-16-6-5-15(10-18)13(3)9-16/h5-9H,10H2,1-4H3 |
| InChIKey | VUELWZAFGPSNSC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|