C16H14BrNO — CID 107276953
2-bromo-4-(2,3,5-trimethylphenoxy)benzonitrile (PubChem CID 107276953) has the molecular formula C16H14BrNO and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-bromo-4-(2,3,5-trimethylphenoxy)benzonitrile.
| Compound Name | 2-bromo-4-(2,3,5-trimethylphenoxy)benzonitrile |
|---|---|
| PubChem CID | 107276953 |
| Molecular Formula | C16H14BrNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-bromo-4-(2,3,5-trimethylphenoxy)benzonitrile |
| SMILES | Cc1cc(C)c(C)c(Oc2ccc(C#N)c(Br)c2)c1 |
| InChI | InChI=1S/C16H14BrNO/c1-10-6-11(2)12(3)16(7-10)19-14-5-4-13(9-18)15(17)8-14/h4-8H,1-3H3 |
| InChIKey | JYNKCUCNFNHFKF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |