C16H22O5 — CID 10708921
(6aR,7S,10aS,10bS)-10b-hydroxy-7,10a-dimethyl-2-oxo-4,6,6a,8,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid (PubChem CID 10708921) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (6aR,7S,10aS,10bS)-10b-hydroxy-7,10a-dimethyl-2-oxo-4,6,6a,8,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid.
| Compound Name | (6aR,7S,10aS,10bS)-10b-hydroxy-7,10a-dimethyl-2-oxo-4,6,6a,8,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid |
|---|---|
| PubChem CID | 10708921 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (6aR,7S,10aS,10bS)-10b-hydroxy-7,10a-dimethyl-2-oxo-4,6,6a,8,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid |
| SMILES | C[C@]12CCC[C@](C)(C(=O)O)[C@@H]1CC=C1COC(=O)C[C@@]12O |
| InChI | InChI=1S/C16H22O5/c1-14(13(18)19)6-3-7-15(2)11(14)5-4-10-9-21-12(17)8-16(10,15)20/h4,11,20H,3,5-9H2,1-2H3,(H,18,19)/t11-,14-,15-,16+/m0/s1 |
| InChIKey | HGTFPKUWRGLEDZ-VCOSZWKGSA-N |
| XLogP | 1.89 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|