C20H30O3 — CID 163019419
2,6,6,15-tetramethyl-12,18-dioxatetracyclo[13.2.1.01,10.02,7]octadec-9-en-13-one (PubChem CID 163019419) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,6,6,15-tetramethyl-12,18-dioxatetracyclo[13.2.1.01,10.02,7]octadec-9-en-13-one.
| Compound Name | 2,6,6,15-tetramethyl-12,18-dioxatetracyclo[13.2.1.01,10.02,7]octadec-9-en-13-one |
|---|---|
| PubChem CID | 163019419 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2,6,6,15-tetramethyl-12,18-dioxatetracyclo[13.2.1.01,10.02,7]octadec-9-en-13-one |
| SMILES | CC12CCC3(O1)C(=CCC1C(C)(C)CCCC13C)COC(=O)C2 |
| InChI | InChI=1S/C20H30O3/c1-17(2)8-5-9-19(4)15(17)7-6-14-13-22-16(21)12-18(3)10-11-20(14,19)23-18/h6,15H,5,7-13H2,1-4H3 |
| InChIKey | KGQVGLJIWBSHKR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|