About CID 124853650
CID 124853650 (PubChem CID 124853650) has the molecular formula C20H28O4
and a molecular weight of 332.44 g/mol.
Molecular Properties
| Compound Name | CID 124853650 |
| PubChem CID | 124853650 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | — |
| SMILES | CC1=CC(=O)[C@@H]2C(C)(C)CCC[C@]2(C)[C@@]12CC[C@]1(COC(=O)C1)O2 |
| InChI | InChI=1S/C20H28O4/c1-13-10-14(21)16-17(2,3)6-5-7-18(16,4)20(13)9-8-19(24-20)11-15(22)23-12-19/h10,16H,5-9,11-12H2,1-4H3/t16-,18+,19+,20-/m1/s1 |
| InChIKey | SXOVHHHRXOYVGV-BTHPGYMESA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 124853650 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 124853650?
The IUPAC name of CID 124853650 (CID 124853650) is not available.
What is the SMILES notation for CID 124853650?
The canonical SMILES for CID 124853650 is CC1=CC(=O)[C@@H]2C(C)(C)CCC[C@]2(C)[C@@]12CC[C@]1(COC(=O)C1)O2.
What is the InChIKey of CID 124853650?
The InChIKey is SXOVHHHRXOYVGV-BTHPGYMESA-N. The full InChI is InChI=1S/C20H28O4/c1-13-10-14(21)16-17(2,3)6-5-7-18(16,4)20(13)9-8-19(24-20)11-15(22)23-12-19/h10,16H,5-9,11-12H2,1-4H3/t16-,18+,19+,20-/m1/s1.
What are the key properties of CID 124853650?
CID 124853650 has a molecular weight of 332.44 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 124853650 is sourced from PubChem (CID 124853650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).