C20H28O5 — CID 46883183
CID 46883183 (PubChem CID 46883183) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol.
| Compound Name | CID 46883183 |
|---|---|
| PubChem CID | 46883183 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2OC(=O)[C@@]3(C)CCC[C@@](C)([C@@H]23)[C@@]12CC[C@@]1(COC(=O)C1)O2 |
| InChI | InChI=1S/C20H28O5/c1-12-9-13-15-17(2,16(22)24-13)5-4-6-18(15,3)20(12)8-7-19(25-20)10-14(21)23-11-19/h12-13,15H,4-11H2,1-3H3/t12-,13-,15+,17+,18+,19-,20-/m1/s1 |
| InChIKey | UHVBVZOAJOXFRA-WBTYJLFFSA-N |
| XLogP | 3.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |