C26H42O6 — CID 163190142
CID 163190142 (PubChem CID 163190142) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol.
| Compound Name | CID 163190142 |
|---|---|
| PubChem CID | 163190142 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | — |
| SMILES | CCCCO[C@H]1OC(=O)C[C@]12CC[C@]1(O2)[C@@H](C)C[C@H](OC(C)=O)[C@@H]2C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C26H42O6/c1-7-8-14-29-22-25(16-20(28)31-22)12-13-26(32-25)17(2)15-19(30-18(3)27)21-23(4,5)10-9-11-24(21,26)6/h17,19,21-22H,7-16H2,1-6H3/t17-,19-,21+,22-,24+,25+,26-/m0/s1 |
| InChIKey | CFJIARCTYBJYBE-VZTUBQQKSA-N |
| XLogP | 5.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|