C21H34O7 — CID 11795162
[(1R,2R,4S,5R,6R,7R,8R)-6-(butoxymethyl)-5,7-dihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-4-yl] acetate (PubChem CID 11795162) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6R,7R,8R)-6-(butoxymethyl)-5,7-dihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-4-yl] acetate.
| Compound Name | [(1R,2R,4S,5R,6R,7R,8R)-6-(butoxymethyl)-5,7-dihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-4-yl] acetate |
|---|---|
| PubChem CID | 11795162 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(1R,2R,4S,5R,6R,7R,8R)-6-(butoxymethyl)-5,7-dihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-4-yl] acetate |
| SMILES | CCCCOC[C@@]1(C)[C@@]2(O)[C@@H](OC(C)=O)C[C@@H](C)[C@@]23CC(=O)O[C@H](C3)[C@]1(C)O |
| InChI | InChI=1S/C21H34O7/c1-6-7-8-26-12-18(4)19(5,24)16-10-20(11-17(23)28-16)13(2)9-15(21(18,20)25)27-14(3)22/h13,15-16,24-25H,6-12H2,1-5H3/t13-,15+,16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | AWVVTJODSDEMIG-JTPVGZPSSA-N |
| XLogP | 1.97 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|