C27H44O4 — CID 160640813
(1R,4S,8R,9R,10R)-9-[2-(2-cycloheptyloxolan-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 160640813) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (1R,4S,8R,9R,10R)-9-[2-(2-cycloheptyloxolan-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1R,4S,8R,9R,10R)-9-[2-(2-cycloheptyloxolan-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 160640813 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (1R,4S,8R,9R,10R)-9-[2-(2-cycloheptyloxolan-3-yl)ethyl]-9-hydroxy-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | C[C@@H]1CC2OC(=O)[C@@]3(C)CCC[C@](C)(C23)[C@@]1(O)CCC1CCOC1C1CCCCCC1 |
| InChI | InChI=1S/C27H44O4/c1-18-17-21-23-25(2,24(28)31-21)13-8-14-26(23,3)27(18,29)15-11-20-12-16-30-22(20)19-9-6-4-5-7-10-19/h18-23,29H,4-17H2,1-3H3/t18-,20?,21?,22?,23?,25+,26-,27-/m1/s1 |
| InChIKey | RJDLIWWFNHIEBZ-SLHOZTBVSA-N |
| XLogP | 5.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |