C20H30O3 — CID 162915590
(1S,4S,8R,9S,10S,12S)-9-[2-(furan-3-yl)ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-ol (PubChem CID 162915590) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,4S,8R,9S,10S,12S)-9-[2-(furan-3-yl)ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-ol.
| Compound Name | (1S,4S,8R,9S,10S,12S)-9-[2-(furan-3-yl)ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-ol |
|---|---|
| PubChem CID | 162915590 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,4S,8R,9S,10S,12S)-9-[2-(furan-3-yl)ethyl]-4,8,10-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecan-9-ol |
| SMILES | C[C@H]1C[C@@H]2OC[C@@]3(C)CCC[C@](C)([C@@H]23)[C@]1(O)CCc1ccoc1 |
| InChI | InChI=1S/C20H30O3/c1-14-11-16-17-18(2,13-23-16)7-4-8-19(17,3)20(14,21)9-5-15-6-10-22-12-15/h6,10,12,14,16-17,21H,4-5,7-9,11,13H2,1-3H3/t14-,16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | GKCSXFCULKOUJN-QYEVSOCMSA-N |
| XLogP | 4.19 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |