C27H36O5 — CID 24848696
methyl (1S,4aS,5R,6R,8R,8aR)-1-benzyl-5-[2-(furan-3-yl)ethyl]-5,8-dihydroxy-4a,6-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 24848696) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is methyl (1S,4aS,5R,6R,8R,8aR)-1-benzyl-5-[2-(furan-3-yl)ethyl]-5,8-dihydroxy-4a,6-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aS,5R,6R,8R,8aR)-1-benzyl-5-[2-(furan-3-yl)ethyl]-5,8-dihydroxy-4a,6-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 24848696 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | methyl (1S,4aS,5R,6R,8R,8aR)-1-benzyl-5-[2-(furan-3-yl)ethyl]-5,8-dihydroxy-4a,6-dimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccccc2)CCC[C@@]2(C)[C@H]1[C@H](O)C[C@@H](C)[C@]2(O)CCc1ccoc1 |
| InChI | InChI=1S/C27H36O5/c1-19-16-22(28)23-25(2,27(19,30)14-10-21-11-15-32-18-21)12-7-13-26(23,24(29)31-3)17-20-8-5-4-6-9-20/h4-6,8-9,11,15,18-19,22-23,28,30H,7,10,12-14,16-17H2,1-3H3/t19-,22-,23-,25+,26+,27-/m1/s1 |
| InChIKey | HQOMGOQKGYPWRS-VJCQHTQMSA-N |
| XLogP | 4.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |