C21H25NO2 — CID 101214366
methyl (3S,4S)-1,3-dibenzyl-4-methylpyrrolidine-3-carboxylate (PubChem CID 101214366) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is methyl (3S,4S)-1,3-dibenzyl-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4S)-1,3-dibenzyl-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 101214366 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | methyl (3S,4S)-1,3-dibenzyl-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccccc2)CN(Cc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C21H25NO2/c1-17-14-22(15-19-11-7-4-8-12-19)16-21(17,20(23)24-2)13-18-9-5-3-6-10-18/h3-12,17H,13-16H2,1-2H3/t17-,21-/m1/s1 |
| InChIKey | WSAITKVZBZHAOS-DYESRHJHSA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |