C19H28INO2 — CID 101414762
methyl (3R,4S)-1-benzyl-4-(iodomethyl)-3-pentylpyrrolidine-3-carboxylate (PubChem CID 101414762) has the molecular formula C19H28INO2 and a molecular weight of 429.34 g/mol. Its IUPAC name is methyl (3R,4S)-1-benzyl-4-(iodomethyl)-3-pentylpyrrolidine-3-carboxylate.
| Compound Name | methyl (3R,4S)-1-benzyl-4-(iodomethyl)-3-pentylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 101414762 |
| Molecular Formula | C19H28INO2 |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | methyl (3R,4S)-1-benzyl-4-(iodomethyl)-3-pentylpyrrolidine-3-carboxylate |
| SMILES | CCCCC[C@]1(C(=O)OC)CN(Cc2ccccc2)C[C@H]1CI |
| InChI | InChI=1S/C19H28INO2/c1-3-4-8-11-19(18(22)23-2)15-21(14-17(19)12-20)13-16-9-6-5-7-10-16/h5-7,9-10,17H,3-4,8,11-15H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | BBROTDDDZUTFCD-MJGOQNOKSA-N |
| XLogP | 4.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|