C22H34O4 — CID 162855372
CID 162855372 (PubChem CID 162855372) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol.
| Compound Name | CID 162855372 |
|---|---|
| PubChem CID | 162855372 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | — |
| SMILES | CCO[C@@H]1C[C@@]2(CC[C@@]3(O2)C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@@]23C)CO1 |
| InChI | InChI=1S/C22H34O4/c1-6-24-17-13-21(14-25-17)10-11-22(26-21)15(2)12-16(23)18-19(3,4)8-7-9-20(18,22)5/h12,17-18H,6-11,13-14H2,1-5H3/t17-,18-,20-,21-,22+/m0/s1 |
| InChIKey | YBRFRBTUTKONGW-OOOLTRJPSA-N |
| XLogP | 4.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |