C22H32O6 — CID 163009634
CID 163009634 (PubChem CID 163009634) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol.
| Compound Name | CID 163009634 |
|---|---|
| PubChem CID | 163009634 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1C(=O)[C@H]2C(C)(C)CCC[C@]2(C)[C@@]2(CC[C@@]3(C=COC3)O2)[C@@]1(C)O |
| InChI | InChI=1S/C22H32O6/c1-14(23)27-17-15(24)16-18(2,3)7-6-8-19(16,4)22(20(17,5)25)10-9-21(28-22)11-12-26-13-21/h11-12,16-17,25H,6-10,13H2,1-5H3/t16-,17-,19-,20-,21-,22-/m0/s1 |
| InChIKey | STWXHEKCQIJYNQ-BJYRRAHNSA-N |
| XLogP | 2.92 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |