C34H38O7 — CID 10840565
[(3R,4aR,5S,6R,6aR,10aS,10bR)-5-benzoyloxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-6-yl] benzoate (PubChem CID 10840565) has the molecular formula C34H38O7 and a molecular weight of 558.67 g/mol. Its IUPAC name is [(3R,4aR,5S,6R,6aR,10aS,10bR)-5-benzoyloxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-6-yl] benzoate.
| Compound Name | [(3R,4aR,5S,6R,6aR,10aS,10bR)-5-benzoyloxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-6-yl] benzoate |
|---|---|
| PubChem CID | 10840565 |
| Molecular Formula | C34H38O7 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | [(3R,4aR,5S,6R,6aR,10aS,10bR)-5-benzoyloxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-6-yl] benzoate |
| SMILES | C=C1CCC[C@H]2[C@@]1(C)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@]1(C)O[C@@]3(CC[C@]21C)COC(=O)C3 |
| InChI | InChI=1S/C34H38O7/c1-22-12-11-17-25-31(2)18-19-34(20-26(35)38-21-34)41-33(31,4)28(40-30(37)24-15-9-6-10-16-24)27(32(22,25)3)39-29(36)23-13-7-5-8-14-23/h5-10,13-16,25,27-28H,1,11-12,17-21H2,2-4H3/t25-,27+,28+,31-,32+,33+,34-/m1/s1 |
| InChIKey | GWWOVTLISDJTFX-YOHSJIAESA-N |
| XLogP | 6.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|