C34H38O8 — CID 162863283
(6-benzoyloxy-5-hydroxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-10-yl) benzoate (PubChem CID 162863283) has the molecular formula C34H38O8 and a molecular weight of 574.67 g/mol. Its IUPAC name is (6-benzoyloxy-5-hydroxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-10-yl) benzoate.
| Compound Name | (6-benzoyloxy-5-hydroxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-10-yl) benzoate |
|---|---|
| PubChem CID | 162863283 |
| Molecular Formula | C34H38O8 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (6-benzoyloxy-5-hydroxy-4a,6a,10b-trimethyl-7-methylidene-2'-oxospiro[1,2,5,6,8,9,10,10a-octahydrobenzo[f]chromene-3,4'-oxolane]-10-yl) benzoate |
| SMILES | C=C1CCC(OC(=O)c2ccccc2)C2C1(C)C(OC(=O)c1ccccc1)C(O)C1(C)OC3(CCC21C)COC(=O)C3 |
| InChI | InChI=1S/C34H38O8/c1-21-15-16-24(40-29(37)22-11-7-5-8-12-22)26-31(2)17-18-34(19-25(35)39-20-34)42-33(31,4)27(36)28(32(21,26)3)41-30(38)23-13-9-6-10-14-23/h5-14,24,26-28,36H,1,15-20H2,2-4H3 |
| InChIKey | CLXVAHOJIMAJAN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|