C34H36O9 — CID 10507605
[(1R,3R,5R,6R,7S,8R,9R,13S)-7-benzoyloxy-3,6-dihydroxy-5,6,9-trimethyl-10-methylidene-3-(5-oxo-2H-furan-3-yl)-2-oxatricyclo[7.3.1.05,13]tridecan-8-yl] benzoate (PubChem CID 10507605) has the molecular formula C34H36O9 and a molecular weight of 588.65 g/mol. Its IUPAC name is [(1R,3R,5R,6R,7S,8R,9R,13S)-7-benzoyloxy-3,6-dihydroxy-5,6,9-trimethyl-10-methylidene-3-(5-oxo-2H-furan-3-yl)-2-oxatricyclo[7.3.1.05,13]tridecan-8-yl] benzoate.
| Compound Name | [(1R,3R,5R,6R,7S,8R,9R,13S)-7-benzoyloxy-3,6-dihydroxy-5,6,9-trimethyl-10-methylidene-3-(5-oxo-2H-furan-3-yl)-2-oxatricyclo[7.3.1.05,13]tridecan-8-yl] benzoate |
|---|---|
| PubChem CID | 10507605 |
| Molecular Formula | C34H36O9 |
| Molecular Weight | 588.65 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | [(1R,3R,5R,6R,7S,8R,9R,13S)-7-benzoyloxy-3,6-dihydroxy-5,6,9-trimethyl-10-methylidene-3-(5-oxo-2H-furan-3-yl)-2-oxatricyclo[7.3.1.05,13]tridecan-8-yl] benzoate |
| SMILES | C=C1CC[C@H]2O[C@@](O)(C3=CC(=O)OC3)C[C@]3(C)[C@@H]2[C@@]1(C)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@]3(C)O |
| InChI | InChI=1S/C34H36O9/c1-20-15-16-24-26-31(2,19-34(39,43-24)23-17-25(35)40-18-23)33(4,38)28(42-30(37)22-13-9-6-10-14-22)27(32(20,26)3)41-29(36)21-11-7-5-8-12-21/h5-14,17,24,26-28,38-39H,1,15-16,18-19H2,2-4H3/t24-,26-,27+,28+,31-,32+,33+,34-/m1/s1 |
| InChIKey | RZWPWVLVPPZVMK-VPWPUGDCSA-N |
| XLogP | 4.14 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|