C27H32O6 — CID 162982806
[(1aR,3aR,4R,5S,7S,7aS,7bS)-5-hydroxy-4,5,7a,7b-tetramethyl-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-1a,2,3,3a,6,7-hexahydronaphtho[1,2-b]oxiren-7-yl] benzoate (PubChem CID 162982806) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is [(1aR,3aR,4R,5S,7S,7aS,7bS)-5-hydroxy-4,5,7a,7b-tetramethyl-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-1a,2,3,3a,6,7-hexahydronaphtho[1,2-b]oxiren-7-yl] benzoate.
| Compound Name | [(1aR,3aR,4R,5S,7S,7aS,7bS)-5-hydroxy-4,5,7a,7b-tetramethyl-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-1a,2,3,3a,6,7-hexahydronaphtho[1,2-b]oxiren-7-yl] benzoate |
|---|---|
| PubChem CID | 162982806 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [(1aR,3aR,4R,5S,7S,7aS,7bS)-5-hydroxy-4,5,7a,7b-tetramethyl-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-1a,2,3,3a,6,7-hexahydronaphtho[1,2-b]oxiren-7-yl] benzoate |
| SMILES | C[C@@]12[C@@H](OC(=O)c3ccccc3)C[C@](C)(O)[C@](C)(C=CC3=CC(=O)OC3)[C@H]1CC[C@H]1O[C@]12C |
| InChI | InChI=1S/C27H32O6/c1-24(13-12-17-14-22(28)31-16-17)19-10-11-20-27(4,33-20)26(19,3)21(15-25(24,2)30)32-23(29)18-8-6-5-7-9-18/h5-9,12-14,19-21,30H,10-11,15-16H2,1-4H3/t19-,20-,21+,24-,25+,26+,27-/m1/s1 |
| InChIKey | UTFOXFCPWDBJJN-ZXLVLULQSA-N |
| XLogP | 3.99 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|