C30H37NO7 — CID 162949652
[3-hydroxy-3,4,8,8a-tetramethyl-2-(2-methylpropanoyloxy)-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-2,4a,5,6-tetrahydro-1H-naphthalen-1-yl] pyridine-3-carboxylate (PubChem CID 162949652) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is [3-hydroxy-3,4,8,8a-tetramethyl-2-(2-methylpropanoyloxy)-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-2,4a,5,6-tetrahydro-1H-naphthalen-1-yl] pyridine-3-carboxylate.
| Compound Name | [3-hydroxy-3,4,8,8a-tetramethyl-2-(2-methylpropanoyloxy)-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-2,4a,5,6-tetrahydro-1H-naphthalen-1-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 162949652 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | [3-hydroxy-3,4,8,8a-tetramethyl-2-(2-methylpropanoyloxy)-4-[2-(5-oxo-2H-furan-3-yl)ethenyl]-2,4a,5,6-tetrahydro-1H-naphthalen-1-yl] pyridine-3-carboxylate |
| SMILES | CC1=CCCC2C1(C)C(OC(=O)c1cccnc1)C(OC(=O)C(C)C)C(C)(O)C2(C)C=CC1=CC(=O)OC1 |
| InChI | InChI=1S/C30H37NO7/c1-18(2)26(33)38-25-24(37-27(34)21-10-8-14-31-16-21)29(5)19(3)9-7-11-22(29)28(4,30(25,6)35)13-12-20-15-23(32)36-17-20/h8-10,12-16,18,22,24-25,35H,7,11,17H2,1-6H3 |
| InChIKey | XPFNYCWPGDNYQC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|