C22H28O2 — CID 100916650
[(1R,2S,5S,7R,9S)-2,6,6-trimethyl-8-methylidene-9-tricyclo[5.2.2.01,5]undecanyl] benzoate (PubChem CID 100916650) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is [(1R,2S,5S,7R,9S)-2,6,6-trimethyl-8-methylidene-9-tricyclo[5.2.2.01,5]undecanyl] benzoate.
| Compound Name | [(1R,2S,5S,7R,9S)-2,6,6-trimethyl-8-methylidene-9-tricyclo[5.2.2.01,5]undecanyl] benzoate |
|---|---|
| PubChem CID | 100916650 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(1R,2S,5S,7R,9S)-2,6,6-trimethyl-8-methylidene-9-tricyclo[5.2.2.01,5]undecanyl] benzoate |
| SMILES | C=C1[C@@H]2CC[C@]3([C@@H](C)CC[C@H]3C2(C)C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O2/c1-14-10-11-18-21(3,4)17-12-13-22(14,18)19(15(17)2)24-20(23)16-8-6-5-7-9-16/h5-9,14,17-19H,2,10-13H2,1,3-4H3/t14-,17-,18-,19-,22+/m0/s1 |
| InChIKey | NHZFYVAXUDGUEH-UUIKUFGASA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|